C26H29FN2O2 — CID 11316115
(4R,4'aS,5R)-1'-(4-fluorophenyl)-4'a-methyl-4,5-bis[(E)-prop-1-enyl]spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] (PubChem CID 11316115) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is (4R,4'aS,5R)-1'-(4-fluorophenyl)-4'a-methyl-4,5-bis[(E)-prop-1-enyl]spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole].
| Compound Name | (4R,4'aS,5R)-1'-(4-fluorophenyl)-4'a-methyl-4,5-bis[(E)-prop-1-enyl]spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
|---|---|
| PubChem CID | 11316115 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (4R,4'aS,5R)-1'-(4-fluorophenyl)-4'a-methyl-4,5-bis[(E)-prop-1-enyl]spiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
| SMILES | C/C=C/[C@H]1OC2(CCCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)O[C@@H]1/C=C/C |
| InChI | InChI=1S/C26H29FN2O2/c1-4-7-23-24(8-5-2)31-26(30-23)14-6-9-19-15-22-18(16-25(19,26)3)17-28-29(22)21-12-10-20(27)11-13-21/h4-5,7-8,10-13,15,17,23-24H,6,9,14,16H2,1-3H3/b7-4+,8-5+/t23-,24-,25+/m1/s1 |
| InChIKey | AEEVMTOUTDXBNY-VUKAXSINSA-N |
| XLogP | 5.77 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|