C24H36O6 — CID 11316117
(2R,4S,6S,8R,10S)-10-methoxy-2-[(4-methoxyphenyl)methoxymethyl]-8-(2-methylidenebutyl)-1,7-dioxaspiro[5.5]undecan-4-ol (PubChem CID 11316117) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is (2R,4S,6S,8R,10S)-10-methoxy-2-[(4-methoxyphenyl)methoxymethyl]-8-(2-methylidenebutyl)-1,7-dioxaspiro[5.5]undecan-4-ol.
| Compound Name | (2R,4S,6S,8R,10S)-10-methoxy-2-[(4-methoxyphenyl)methoxymethyl]-8-(2-methylidenebutyl)-1,7-dioxaspiro[5.5]undecan-4-ol |
|---|---|
| PubChem CID | 11316117 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (2R,4S,6S,8R,10S)-10-methoxy-2-[(4-methoxyphenyl)methoxymethyl]-8-(2-methylidenebutyl)-1,7-dioxaspiro[5.5]undecan-4-ol |
| SMILES | C=C(CC)C[C@@H]1C[C@H](OC)C[C@@]2(C[C@@H](O)C[C@H](COCc3ccc(OC)cc3)O2)O1 |
| InChI | InChI=1S/C24H36O6/c1-5-17(2)10-21-12-22(27-4)14-24(29-21)13-19(25)11-23(30-24)16-28-15-18-6-8-20(26-3)9-7-18/h6-9,19,21-23,25H,2,5,10-16H2,1,3-4H3/t19-,21+,22-,23+,24-/m0/s1 |
| InChIKey | ANVNQAXXZRNGES-IBXSQZDTSA-N |
| XLogP | 4.00 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|