C22H35NO5Si — CID 11316154
benzyl (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11316154) has the molecular formula C22H35NO5Si and a molecular weight of 421.61 g/mol. Its IUPAC name is benzyl (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11316154 |
| Molecular Formula | C22H35NO5Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | benzyl (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-ethoxy-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC1C=C[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H35NO5Si/c1-7-26-20-14-13-19(24)18(16-28-29(5,6)22(2,3)4)23(20)21(25)27-15-17-11-9-8-10-12-17/h8-14,18-20,24H,7,15-16H2,1-6H3/t18-,19-,20?/m1/s1 |
| InChIKey | QHGFQADVIRYRDK-LEAGNCFPSA-N |
| XLogP | 4.31 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|