C21H24FN3O2 — CID 113162185
N-[(2-fluorophenyl)methyl]-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]acetamide (PubChem CID 113162185) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]acetamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 113162185 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCN(c2ccccc2)CC1)Cc1ccccc1F |
| InChI | InChI=1S/C21H24FN3O2/c1-17(26)25(15-18-7-5-6-10-20(18)22)16-21(27)24-13-11-23(12-14-24)19-8-3-2-4-9-19/h2-10H,11-16H2,1H3 |
| InChIKey | OGVRYUPNMMMQAG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |