C23H44O3Si2 — CID 11316231
ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-triethylsilylhept-2-en-6-ynoate (PubChem CID 11316231) has the molecular formula C23H44O3Si2 and a molecular weight of 424.77 g/mol. Its IUPAC name is ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-triethylsilylhept-2-en-6-ynoate.
| Compound Name | ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-triethylsilylhept-2-en-6-ynoate |
|---|---|
| PubChem CID | 11316231 |
| Molecular Formula | C23H44O3Si2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | ethyl (E,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-7-triethylsilylhept-2-en-6-ynoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)[C@@H](C#C[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si2/c1-12-25-22(24)20(6)18-19(5)21(26-27(10,11)23(7,8)9)16-17-28(13-2,14-3)15-4/h18-19,21H,12-15H2,1-11H3/b20-18+/t19-,21-/m1/s1 |
| InChIKey | KMTRYDWZZHSFOD-BTSWKGTJSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|