C18H19FN2O3 — CID 113162953
2-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 113162953) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113162953 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[acetyl-[(2-methoxyphenyl)methyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccccc1CN(CC(=O)Nc1ccc(F)cc1)C(C)=O |
| InChI | InChI=1S/C18H19FN2O3/c1-13(22)21(11-14-5-3-4-6-17(14)24-2)12-18(23)20-16-9-7-15(19)8-10-16/h3-10H,11-12H2,1-2H3,(H,20,23) |
| InChIKey | XFDBZTFZDMDLGJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |