About 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole
9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole (PubChem CID 11316308) has the molecular formula C22H20ClF2N5
and a molecular weight of 427.89 g/mol. Its IUPAC name is 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole.
Molecular Properties
| Compound Name | 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole |
| PubChem CID | 11316308 |
| Molecular Formula | C22H20ClF2N5 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole |
| SMILES | Fc1ccc(CCN2CCN(c3ncnc4c3[nH]c3cccc(Cl)c34)CC2)cc1F |
| InChI | InChI=1S/C22H20ClF2N5/c23-15-2-1-3-18-19(15)20-21(28-18)22(27-13-26-20)30-10-8-29(9-11-30)7-6-14-4-5-16(24)17(25)12-14/h1-5,12-13,28H,6-11H2 |
| InChIKey | CMSDBAJZSYLKFD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole?
The IUPAC name of 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole (CID 11316308) is 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole.
What is the SMILES notation for 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole?
The canonical SMILES for 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole is Fc1ccc(CCN2CCN(c3ncnc4c3[nH]c3cccc(Cl)c34)CC2)cc1F.
What is the InChIKey of 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole?
The InChIKey is CMSDBAJZSYLKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20ClF2N5/c23-15-2-1-3-18-19(15)20-21(28-18)22(27-13-26-20)30-10-8-29(9-11-30)7-6-14-4-5-16(24)17(25)12-14/h1-5,12-13,28H,6-11H2.
What are the key properties of 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole?
9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole has a molecular weight of 427.89 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-4-[4-[2-(3,4-difluorophenyl)ethyl]piperazin-1-yl]-5H-pyrimido[5,4-b]indole is sourced from PubChem (CID 11316308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).