C18H18F2N2O2 — CID 113164409
2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]-N-(2-fluorophenyl)acetamide (PubChem CID 113164409) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113164409 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]-N-(2-fluorophenyl)acetamide |
| SMILES | CC(=O)N(CCc1ccc(F)cc1)CC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C18H18F2N2O2/c1-13(23)22(11-10-14-6-8-15(19)9-7-14)12-18(24)21-17-5-3-2-4-16(17)20/h2-9H,10-12H2,1H3,(H,21,24) |
| InChIKey | LEBSLZJUTQVNMW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |