C18H29N3O3 — CID 113164495
2-[acetyl-[2-(2-methoxyphenyl)ethyl]amino]-N-[3-(dimethylamino)propyl]acetamide (PubChem CID 113164495) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[acetyl-[2-(2-methoxyphenyl)ethyl]amino]-N-[3-(dimethylamino)propyl]acetamide.
| Compound Name | 2-[acetyl-[2-(2-methoxyphenyl)ethyl]amino]-N-[3-(dimethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 113164495 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 2-[acetyl-[2-(2-methoxyphenyl)ethyl]amino]-N-[3-(dimethylamino)propyl]acetamide |
| SMILES | COc1ccccc1CCN(CC(=O)NCCCN(C)C)C(C)=O |
| InChI | InChI=1S/C18H29N3O3/c1-15(22)21(14-18(23)19-11-7-12-20(2)3)13-10-16-8-5-6-9-17(16)24-4/h5-6,8-9H,7,10-14H2,1-4H3,(H,19,23) |
| InChIKey | RRHYRWIQLQUMLP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|