C20H21N3O3 — CID 113164937
2-[acetyl-[2-(4-methoxyphenyl)ethyl]amino]-N-(3-cyanophenyl)acetamide (PubChem CID 113164937) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[acetyl-[2-(4-methoxyphenyl)ethyl]amino]-N-(3-cyanophenyl)acetamide.
| Compound Name | 2-[acetyl-[2-(4-methoxyphenyl)ethyl]amino]-N-(3-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 113164937 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[acetyl-[2-(4-methoxyphenyl)ethyl]amino]-N-(3-cyanophenyl)acetamide |
| SMILES | COc1ccc(CCN(CC(=O)Nc2cccc(C#N)c2)C(C)=O)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-15(24)23(11-10-16-6-8-19(26-2)9-7-16)14-20(25)22-18-5-3-4-17(12-18)13-21/h3-9,12H,10-11,14H2,1-2H3,(H,22,25) |
| InChIKey | VUKQRKRMJJTPTD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |