C23H24N4O3S — CID 11316519
N,N-dibenzyl-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide (PubChem CID 11316519) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N,N-dibenzyl-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide.
| Compound Name | N,N-dibenzyl-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide |
|---|---|
| PubChem CID | 11316519 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N,N-dibenzyl-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide |
| SMILES | O=c1nc(/N=C/N(Cc2ccccc2)Cc2ccccc2)ccn1[C@H]1CS[C@@H](CO)O1 |
| InChI | InChI=1S/C23H24N4O3S/c28-15-22-30-21(16-31-22)27-12-11-20(25-23(27)29)24-17-26(13-18-7-3-1-4-8-18)14-19-9-5-2-6-10-19/h1-12,17,21-22,28H,13-16H2/b24-17+/t21-,22+/m1/s1 |
| InChIKey | OWXGYEFOPHUMFC-SBURRRBISA-N |
| XLogP | 3.19 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|