C14H28N2O2 — CID 113166139
2-[acetyl(tert-butyl)amino]-N,N-dipropylacetamide (PubChem CID 113166139) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[acetyl(tert-butyl)amino]-N,N-dipropylacetamide.
| Compound Name | 2-[acetyl(tert-butyl)amino]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 113166139 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-[acetyl(tert-butyl)amino]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CN(C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O2/c1-7-9-15(10-8-2)13(18)11-16(12(3)17)14(4,5)6/h7-11H2,1-6H3 |
| InChIKey | XFJFLDKBKHBJGB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |