C15H19N3O2 — CID 113166246
2-[acetyl(tert-butyl)amino]-N-(4-cyanophenyl)acetamide (PubChem CID 113166246) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[acetyl(tert-butyl)amino]-N-(4-cyanophenyl)acetamide.
| Compound Name | 2-[acetyl(tert-butyl)amino]-N-(4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 113166246 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[acetyl(tert-butyl)amino]-N-(4-cyanophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(C#N)cc1)C(C)(C)C |
| InChI | InChI=1S/C15H19N3O2/c1-11(19)18(15(2,3)4)10-14(20)17-13-7-5-12(9-16)6-8-13/h5-8H,10H2,1-4H3,(H,17,20) |
| InChIKey | GTFPFPWYGMNZAN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |