C17H30F3N5O5 — CID 11316642
tert-butyl N-[2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]ethyl]carbamate (PubChem CID 11316642) has the molecular formula C17H30F3N5O5 and a molecular weight of 441.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 11316642 |
| Molecular Formula | C17H30F3N5O5 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | tert-butyl N-[2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC/N=C(\NCCNC(=O)OC(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H30F3N5O5/c1-15(2,3)29-13(27)23-9-7-21-12(25-11(26)17(18,19)20)22-8-10-24-14(28)30-16(4,5)6/h7-10H2,1-6H3,(H,23,27)(H,24,28)(H2,21,22,25,26) |
| InChIKey | XUWHLHLWJSJVCJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|