C18H19ClN2O2 — CID 113167376
2-(N-acetyl-2-methylanilino)-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 113167376) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 2-(N-acetyl-2-methylanilino)-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-(N-acetyl-2-methylanilino)-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113167376 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(N-acetyl-2-methylanilino)-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1cccc(Cl)c1C)c1ccccc1C |
| InChI | InChI=1S/C18H19ClN2O2/c1-12-7-4-5-10-17(12)21(14(3)22)11-18(23)20-16-9-6-8-15(19)13(16)2/h4-10H,11H2,1-3H3,(H,20,23) |
| InChIKey | HKJWVIPMCJUPLQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |