C10H3F17 — CID 11316770
(E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-4-(trifluoromethyl)pent-2-ene (PubChem CID 11316770) has the molecular formula C10H3F17 and a molecular weight of 446.10 g/mol. Its IUPAC name is (E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-4-(trifluoromethyl)pent-2-ene.
| Compound Name | (E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 11316770 |
| Molecular Formula | C10H3F17 |
| Molecular Weight | 446.10 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | (E)-1,1,1,2,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-4-(trifluoromethyl)pent-2-ene |
| SMILES | CC(/C(=C(\F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H3F17/c1-4(7(16,17)18,8(19,20)21)2(3(11)6(13,14)15)5(12,9(22,23)24)10(25,26)27/h1H3/b3-2+ |
| InChIKey | RMKAQSJKBPBPOE-NSCUHMNNSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.10 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |