C18H17N5O5S2 — CID 11316813
N-[5-nitro-2-(piperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 11316813) has the molecular formula C18H17N5O5S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[5-nitro-2-(piperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[5-nitro-2-(piperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 11316813 |
| Molecular Formula | C18H17N5O5S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[5-nitro-2-(piperidine-1-carbonyl)phenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1cccc2nsnc12)N1CCCCC1 |
| InChI | InChI=1S/C18H17N5O5S2/c24-18(22-9-2-1-3-10-22)13-8-7-12(23(25)26)11-15(13)21-30(27,28)16-6-4-5-14-17(16)20-29-19-14/h4-8,11,21H,1-3,9-10H2 |
| InChIKey | QQNMLURCXJYAMV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|