C19H22N2O2 — CID 113168713
2-(N-acetyl-2,6-dimethylanilino)-N-(2-methylphenyl)acetamide (PubChem CID 113168713) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-(N-acetyl-2,6-dimethylanilino)-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(N-acetyl-2,6-dimethylanilino)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 113168713 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-(N-acetyl-2,6-dimethylanilino)-N-(2-methylphenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccccc1C)c1c(C)cccc1C |
| InChI | InChI=1S/C19H22N2O2/c1-13-8-5-6-11-17(13)20-18(23)12-21(16(4)22)19-14(2)9-7-10-15(19)3/h5-11H,12H2,1-4H3,(H,20,23) |
| InChIKey | APYWYQWODIFLMS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |