C18H28N2O2 — CID 113170295
2-(N-acetyl-2-methyl-6-propan-2-ylanilino)-N,N-diethylacetamide (PubChem CID 113170295) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-(N-acetyl-2-methyl-6-propan-2-ylanilino)-N,N-diethylacetamide.
| Compound Name | 2-(N-acetyl-2-methyl-6-propan-2-ylanilino)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 113170295 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-(N-acetyl-2-methyl-6-propan-2-ylanilino)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C(C)=O)c1c(C)cccc1C(C)C |
| InChI | InChI=1S/C18H28N2O2/c1-7-19(8-2)17(22)12-20(15(6)21)18-14(5)10-9-11-16(18)13(3)4/h9-11,13H,7-8,12H2,1-6H3 |
| InChIKey | YLQVCOUGHYZSJQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |