C24H24N6O4 — CID 11317130
(2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11317130) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11317130 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[8-anilino-6-(2,3-dihydroindol-1-yl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2c(Nc3ccccc3)nc3c(N4CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H24N6O4/c31-12-17-19(32)20(33)23(34-17)30-22-18(28-24(30)27-15-7-2-1-3-8-15)21(25-13-26-22)29-11-10-14-6-4-5-9-16(14)29/h1-9,13,17,19-20,23,31-33H,10-12H2,(H,27,28)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | AOFQWNWLLGZQNE-ZDXOVATRSA-N |
| XLogP | 1.88 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |