About ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate
ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate (PubChem CID 11317157) has the molecular formula C11H9F6NO8S2
and a molecular weight of 461.31 g/mol. Its IUPAC name is ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
| PubChem CID | 11317157 |
| Molecular Formula | C11H9F6NO8S2 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.97 |
| IUPAC Name | ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(OS(=O)(=O)C(F)(F)F)cc(C)nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H9F6NO8S2/c1-3-24-9(19)7-6(25-27(20,21)10(12,13)14)4-5(2)18-8(7)26-28(22,23)11(15,16)17/h4H,3H2,1-2H3 |
| InChIKey | AIFYXJCCGVXNSJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 125.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate?
The IUPAC name of ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate (CID 11317157) is ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate?
The canonical SMILES for ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate is CCOC(=O)c1c(OS(=O)(=O)C(F)(F)F)cc(C)nc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate?
The InChIKey is AIFYXJCCGVXNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F6NO8S2/c1-3-24-9(19)7-6(25-27(20,21)10(12,13)14)4-5(2)18-8(7)26-28(22,23)11(15,16)17/h4H,3H2,1-2H3.
What are the key properties of ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate?
ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate has a molecular weight of 461.31 g/mol, XLogP of 2.02, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-methyl-2,4-bis(trifluoromethylsulfonyloxy)pyridine-3-carboxylate is sourced from PubChem (CID 11317157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).