C26H19N5O4 — CID 11317239
(11S)-11-(2-methyl-4-oxoquinazolin-3-yl)-6-nitro-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one (PubChem CID 11317239) has the molecular formula C26H19N5O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is (11S)-11-(2-methyl-4-oxoquinazolin-3-yl)-6-nitro-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one.
| Compound Name | (11S)-11-(2-methyl-4-oxoquinazolin-3-yl)-6-nitro-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one |
|---|---|
| PubChem CID | 11317239 |
| Molecular Formula | C26H19N5O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (11S)-11-(2-methyl-4-oxoquinazolin-3-yl)-6-nitro-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-12-one |
| SMILES | Cc1nc2ccccc2c(=O)n1[C@@H]1N=C(c2ccccc2)c2cc([N+](=O)[O-])cc3c2N(CC3)C1=O |
| InChI | InChI=1S/C26H19N5O4/c1-15-27-21-10-6-5-9-19(21)25(32)30(15)24-26(33)29-12-11-17-13-18(31(34)35)14-20(23(17)29)22(28-24)16-7-3-2-4-8-16/h2-10,13-14,24H,11-12H2,1H3/t24-/m0/s1 |
| InChIKey | RGERZKVLIURXPY-DEOSSOPVSA-N |
| XLogP | 3.55 |
| TPSA | 110.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|