C26H46O5Si — CID 11317286
(2R,3R,4S)-4-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-methyl-3-tri(propan-2-yl)silyloxypentan-1-ol (PubChem CID 11317286) has the molecular formula C26H46O5Si and a molecular weight of 466.74 g/mol. Its IUPAC name is (2R,3R,4S)-4-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-methyl-3-tri(propan-2-yl)silyloxypentan-1-ol.
| Compound Name | (2R,3R,4S)-4-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-methyl-3-tri(propan-2-yl)silyloxypentan-1-ol |
|---|---|
| PubChem CID | 11317286 |
| Molecular Formula | C26H46O5Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | (2R,3R,4S)-4-[(2S,4S)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]-2-methyl-3-tri(propan-2-yl)silyloxypentan-1-ol |
| SMILES | COc1ccc([C@H]2OCC[C@@H]([C@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)CO)O2)cc1 |
| InChI | InChI=1S/C26H46O5Si/c1-17(2)32(18(3)4,19(5)6)31-25(20(7)16-27)21(8)24-14-15-29-26(30-24)22-10-12-23(28-9)13-11-22/h10-13,17-21,24-27H,14-16H2,1-9H3/t20-,21+,24+,25-,26+/m1/s1 |
| InChIKey | KKGJYKJCEBWOGD-WYMBGIKYSA-N |
| XLogP | 6.32 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|