C21H33NO7SSi — CID 11317407
prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(oxolane-2-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate (PubChem CID 11317407) has the molecular formula C21H33NO7SSi and a molecular weight of 471.65 g/mol. Its IUPAC name is prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(oxolane-2-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate.
| Compound Name | prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(oxolane-2-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 11317407 |
| Molecular Formula | C21H33NO7SSi |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(oxolane-2-carbonylsulfanyl)azetidin-1-yl]-2-oxoacetate |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=O)C1CCCO1 |
| InChI | InChI=1S/C21H33NO7SSi/c1-8-11-28-19(25)17(24)22-16(23)15(13(2)29-31(6,7)21(3,4)5)18(22)30-20(26)14-10-9-12-27-14/h8,13-15,18H,1,9-12H2,2-7H3/t13-,14?,15+,18-/m1/s1 |
| InChIKey | WZUMZXAKQCQYFR-NYELBAIQSA-N |
| XLogP | 2.88 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|