C20H24N2O5 — CID 113174616
2-(N-acetyl-2,5-dimethoxyanilino)-N-(2-ethoxyphenyl)acetamide (PubChem CID 113174616) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(N-acetyl-2,5-dimethoxyanilino)-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-(N-acetyl-2,5-dimethoxyanilino)-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113174616 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-(N-acetyl-2,5-dimethoxyanilino)-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN(C(C)=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C20H24N2O5/c1-5-27-18-9-7-6-8-16(18)21-20(24)13-22(14(2)23)17-12-15(25-3)10-11-19(17)26-4/h6-12H,5,13H2,1-4H3,(H,21,24) |
| InChIKey | UOBIGHKJWBOXSI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |