C17H21F3N2O2 — CID 113175111
N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 113175111) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113175111 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCC(C)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-12-6-8-21(9-7-12)16(24)11-22(13(2)23)15-5-3-4-14(10-15)17(18,19)20/h3-5,10,12H,6-9,11H2,1-2H3 |
| InChIKey | UZDYNDDCELPCPY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |