C17H13F5N2O2 — CID 113175232
2-[N-acetyl-3-(trifluoromethyl)anilino]-N-(2,6-difluorophenyl)acetamide (PubChem CID 113175232) has the molecular formula C17H13F5N2O2 and a molecular weight of 372.29 g/mol. Its IUPAC name is 2-[N-acetyl-3-(trifluoromethyl)anilino]-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-[N-acetyl-3-(trifluoromethyl)anilino]-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 113175232 |
| Molecular Formula | C17H13F5N2O2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[N-acetyl-3-(trifluoromethyl)anilino]-N-(2,6-difluorophenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1c(F)cccc1F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F5N2O2/c1-10(25)24(12-5-2-4-11(8-12)17(20,21)22)9-15(26)23-16-13(18)6-3-7-14(16)19/h2-8H,9H2,1H3,(H,23,26) |
| InChIKey | XNCXKKNKATUFRV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |