C26H25N7O3 — CID 11317679
5-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypentanoic acid (PubChem CID 11317679) has the molecular formula C26H25N7O3 and a molecular weight of 483.53 g/mol. Its IUPAC name is 5-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypentanoic acid.
| Compound Name | 5-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 11317679 |
| Molecular Formula | C26H25N7O3 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 5-[11-[(2,4-diaminopteridin-6-yl)methyl]benzo[b][1]benzazepin-3-yl]oxypentanoic acid |
| SMILES | Nc1nc(N)c2nc(CN3c4ccccc4C=Cc4cc(OCCCCC(=O)O)ccc43)cnc2n1 |
| InChI | InChI=1S/C26H25N7O3/c27-24-23-25(32-26(28)31-24)29-14-18(30-23)15-33-20-6-2-1-5-16(20)8-9-17-13-19(10-11-21(17)33)36-12-4-3-7-22(34)35/h1-2,5-6,8-11,13-14H,3-4,7,12,15H2,(H,34,35)(H4,27,28,29,31,32) |
| InChIKey | FVANIGOOFXRYPN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|