C20H33N3O2 — CID 113176880
2-[N-acetyl-4-(diethylamino)anilino]-N,N-dipropylacetamide (PubChem CID 113176880) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-[N-acetyl-4-(diethylamino)anilino]-N,N-dipropylacetamide.
| Compound Name | 2-[N-acetyl-4-(diethylamino)anilino]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 113176880 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2-[N-acetyl-4-(diethylamino)anilino]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)CN(C(C)=O)c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C20H33N3O2/c1-6-14-22(15-7-2)20(25)16-23(17(5)24)19-12-10-18(11-13-19)21(8-3)9-4/h10-13H,6-9,14-16H2,1-5H3 |
| InChIKey | NUQSWCYDGYJSDG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|