C24H29N3O2 — CID 113177148
N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 113177148) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 113177148 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCCc2ccccc21)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-19(28)27(22-13-11-21(12-14-22)25-15-5-2-6-16-25)18-24(29)26-17-7-9-20-8-3-4-10-23(20)26/h3-4,8,10-14H,2,5-7,9,15-18H2,1H3 |
| InChIKey | BKSZNOURSKEWSN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|