C28H33N3O3S — CID 11317854
(2-sulfanylidene-1-pyridinyl) (2S,3aR,8bR)-3-acetyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2-carboxylate (PubChem CID 11317854) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) (2S,3aR,8bR)-3-acetyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2-carboxylate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) (2S,3aR,8bR)-3-acetyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 11317854 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) (2S,3aR,8bR)-3-acetyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole-2-carboxylate |
| SMILES | CC(=O)N1[C@H]2N(CC=C(C)C)c3ccccc3[C@@]2(CC=C(C)C)C[C@H]1C(=O)On1ccccc1=S |
| InChI | InChI=1S/C28H33N3O3S/c1-19(2)13-15-28-18-24(26(33)34-30-16-9-8-12-25(30)35)31(21(5)32)27(28)29(17-14-20(3)4)23-11-7-6-10-22(23)28/h6-14,16,24,27H,15,17-18H2,1-5H3/t24-,27+,28+/m0/s1 |
| InChIKey | IPLIOXXOVKRNIZ-HNPKZYAISA-N |
| XLogP | 5.20 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|