C24H33N3O2 — CID 113178618
2-[N-acetyl-2,6-di(propan-2-yl)anilino]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 113178618) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[N-acetyl-2,6-di(propan-2-yl)anilino]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[N-acetyl-2,6-di(propan-2-yl)anilino]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 113178618 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[N-acetyl-2,6-di(propan-2-yl)anilino]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc(N(C)C)cc1)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C24H33N3O2/c1-16(2)21-9-8-10-22(17(3)4)24(21)27(18(5)28)15-23(29)25-19-11-13-20(14-12-19)26(6)7/h8-14,16-17H,15H2,1-7H3,(H,25,29) |
| InChIKey | DWCBVGKXLKLMAW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|