C18H28N2O5 — CID 113179148
2-(N-acetyl-3,4,5-trimethoxyanilino)-N-butyl-N-methylacetamide (PubChem CID 113179148) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-(N-acetyl-3,4,5-trimethoxyanilino)-N-butyl-N-methylacetamide.
| Compound Name | 2-(N-acetyl-3,4,5-trimethoxyanilino)-N-butyl-N-methylacetamide |
|---|---|
| PubChem CID | 113179148 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-(N-acetyl-3,4,5-trimethoxyanilino)-N-butyl-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)CN(C(C)=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O5/c1-7-8-9-19(3)17(22)12-20(13(2)21)14-10-15(23-4)18(25-6)16(11-14)24-5/h10-11H,7-9,12H2,1-6H3 |
| InChIKey | VJSCEEIJUFVPND-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |