About naphthalene-1,2-diol
naphthalene-1,2-diol (PubChem CID 11318) has the molecular formula C10H8O2
and a molecular weight of 160.17 g/mol. Its IUPAC name is naphthalene-1,2-diol.
Molecular Properties
| Compound Name | naphthalene-1,2-diol |
| PubChem CID | 11318 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | naphthalene-1,2-diol |
| SMILES | Oc1ccc2ccccc2c1O |
| InChI | InChI=1S/C10H8O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,11-12H |
| InChIKey | NXPPAOGUKPJVDI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,2-diol?
The IUPAC name of naphthalene-1,2-diol (CID 11318) is naphthalene-1,2-diol.
What is the SMILES notation for naphthalene-1,2-diol?
The canonical SMILES for naphthalene-1,2-diol is Oc1ccc2ccccc2c1O.
What is the InChIKey of naphthalene-1,2-diol?
The InChIKey is NXPPAOGUKPJVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,11-12H.
What are the key properties of naphthalene-1,2-diol?
naphthalene-1,2-diol has a molecular weight of 160.17 g/mol, XLogP of 2.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,2-diol is sourced from PubChem (CID 11318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).