C16H15N3O3 — CID 113180649
2-(N-acetyl-2-cyanoanilino)-N-(furan-2-ylmethyl)acetamide (PubChem CID 113180649) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(N-acetyl-2-cyanoanilino)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(N-acetyl-2-cyanoanilino)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 113180649 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(N-acetyl-2-cyanoanilino)-N-(furan-2-ylmethyl)acetamide |
| SMILES | CC(=O)N(CC(=O)NCc1ccco1)c1ccccc1C#N |
| InChI | InChI=1S/C16H15N3O3/c1-12(20)19(15-7-3-2-5-13(15)9-17)11-16(21)18-10-14-6-4-8-22-14/h2-8H,10-11H2,1H3,(H,18,21) |
| InChIKey | MBJZCQPWGSWEIB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |