C23H30FN3O2 — CID 113182342
1-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 113182342) has the molecular formula C23H30FN3O2 and a molecular weight of 399.51 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 113182342 |
| Molecular Formula | C23H30FN3O2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-4-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCN(c3ccccc3F)CC2)CN1CCC1=CCCCC1 |
| InChI | InChI=1S/C23H30FN3O2/c24-20-8-4-5-9-21(20)25-12-14-26(15-13-25)23(29)19-16-22(28)27(17-19)11-10-18-6-2-1-3-7-18/h4-6,8-9,19H,1-3,7,10-17H2 |
| InChIKey | MFDBDDORHWLXLL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|