C25H28N8O5 — CID 11318367
N-hydroxy-N',N'-bis[2-(1H-indazol-5-ylamino)-2-oxoethyl]heptanediamide (PubChem CID 11318367) has the molecular formula C25H28N8O5 and a molecular weight of 520.55 g/mol. Its IUPAC name is N-hydroxy-N',N'-bis[2-(1H-indazol-5-ylamino)-2-oxoethyl]heptanediamide.
| Compound Name | N-hydroxy-N',N'-bis[2-(1H-indazol-5-ylamino)-2-oxoethyl]heptanediamide |
|---|---|
| PubChem CID | 11318367 |
| Molecular Formula | C25H28N8O5 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | N-hydroxy-N',N'-bis[2-(1H-indazol-5-ylamino)-2-oxoethyl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)N(CC(=O)Nc1ccc2[nH]ncc2c1)CC(=O)Nc1ccc2[nH]ncc2c1)NO |
| InChI | InChI=1S/C25H28N8O5/c34-22(32-38)4-2-1-3-5-25(37)33(14-23(35)28-18-6-8-20-16(10-18)12-26-30-20)15-24(36)29-19-7-9-21-17(11-19)13-27-31-21/h6-13,38H,1-5,14-15H2,(H,26,30)(H,27,31)(H,28,35)(H,29,36)(H,32,34) |
| InChIKey | RXZWNENIWFABET-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 185.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|