C20H20F2N2O2 — CID 113184212
1-[2-(2-fluorophenyl)ethyl]-N-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 113184212) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-N-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-N-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113184212 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-N-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C1CC(=O)N(CCc2ccccc2F)C1 |
| InChI | InChI=1S/C20H20F2N2O2/c21-17-7-5-14(6-8-17)12-23-20(26)16-11-19(25)24(13-16)10-9-15-3-1-2-4-18(15)22/h1-8,16H,9-13H2,(H,23,26) |
| InChIKey | KHGKTLLNIBYUOG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |