C22H30N2O2 — CID 113185261
N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxamide (PubChem CID 113185261) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113185261 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CC(=O)N(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C22H30N2O2/c25-21-16-20(22(26)23-14-13-19-10-5-2-6-11-19)17-24(21)15-7-12-18-8-3-1-4-9-18/h1,3-4,8-10,20H,2,5-7,11-17H2,(H,23,26) |
| InChIKey | XAUIBTDBSLCVCA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|