C29H38Cl2N4O — CID 11318528
N-[2-(2,4-dichlorophenyl)ethyl]-4-[(N,N'-dicyclohexyl-N-methylcarbamimidoyl)amino]benzamide (PubChem CID 11318528) has the molecular formula C29H38Cl2N4O and a molecular weight of 529.56 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-[(N,N'-dicyclohexyl-N-methylcarbamimidoyl)amino]benzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[(N,N'-dicyclohexyl-N-methylcarbamimidoyl)amino]benzamide |
|---|---|
| PubChem CID | 11318528 |
| Molecular Formula | C29H38Cl2N4O |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[(N,N'-dicyclohexyl-N-methylcarbamimidoyl)amino]benzamide |
| SMILES | CN(/C(=N\C1CCCCC1)Nc1ccc(C(=O)NCCc2ccc(Cl)cc2Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C29H38Cl2N4O/c1-35(26-10-6-3-7-11-26)29(33-24-8-4-2-5-9-24)34-25-16-13-22(14-17-25)28(36)32-19-18-21-12-15-23(30)20-27(21)31/h12-17,20,24,26H,2-11,18-19H2,1H3,(H,32,36)(H,33,34) |
| InChIKey | NUZLZQHKXQREHT-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|