C23H33N3O3 — CID 113185530
1-cycloheptyl-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 113185530) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-cycloheptyl-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-cycloheptyl-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 113185530 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-cycloheptyl-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)C3CC(=O)N(C4CCCCCC4)C3)CC2)cc1 |
| InChI | InChI=1S/C23H33N3O3/c1-29-21-10-8-19(9-11-21)24-12-14-25(15-13-24)23(28)18-16-22(27)26(17-18)20-6-4-2-3-5-7-20/h8-11,18,20H,2-7,12-17H2,1H3 |
| InChIKey | AHEYTJIHPYNDPX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|