C15H26N2O4S — CID 113185684
N-(1,1-dioxothiolan-3-yl)-N-methyl-5-oxo-1-pentylpyrrolidine-3-carboxamide (PubChem CID 113185684) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-5-oxo-1-pentylpyrrolidine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-5-oxo-1-pentylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113185684 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-5-oxo-1-pentylpyrrolidine-3-carboxamide |
| SMILES | CCCCCN1CC(C(=O)N(C)C2CCS(=O)(=O)C2)CC1=O |
| InChI | InChI=1S/C15H26N2O4S/c1-3-4-5-7-17-10-12(9-14(17)18)15(19)16(2)13-6-8-22(20,21)11-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | DPPSIOVVFWYEFZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|