C19H27N3O4 — CID 113185700
4-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-pentylpyrrolidin-2-one (PubChem CID 113185700) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-pentylpyrrolidin-2-one.
| Compound Name | 4-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-pentylpyrrolidin-2-one |
|---|---|
| PubChem CID | 113185700 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-pentylpyrrolidin-2-one |
| SMILES | CCCCCN1CC(C(=O)N2CCN(C(=O)c3ccco3)CC2)CC1=O |
| InChI | InChI=1S/C19H27N3O4/c1-2-3-4-7-22-14-15(13-17(22)23)18(24)20-8-10-21(11-9-20)19(25)16-6-5-12-26-16/h5-6,12,15H,2-4,7-11,13-14H2,1H3 |
| InChIKey | MMDWATKYMBHNJX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|