C29H60O5Si2 — CID 11318762
[(Z,2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enyl] 2,2-dimethylpropanoate (PubChem CID 11318762) has the molecular formula C29H60O5Si2 and a molecular weight of 544.97 g/mol. Its IUPAC name is [(Z,2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(Z,2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11318762 |
| Molecular Formula | C29H60O5Si2 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | [(Z,2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-enyl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C/C[C@@H](CO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C)CCC[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C29H60O5Si2/c1-24(15-14-16-25(2)21-32-27(30)28(3,4)5)17-18-26(22-34-36(12,13)29(6,7)8)33-23-31-19-20-35(9,10)11/h17,25-26H,14-16,18-23H2,1-13H3/b24-17-/t25-,26-/m0/s1 |
| InChIKey | IEDKQABARNKBFK-DZDNEBMNSA-N |
| XLogP | 8.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|