C20H17F3N2O3 — CID 113188969
1-(4-acetylphenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 113188969) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-acetylphenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113188969 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-(4-acetylphenyl)-5-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CC(=O)c1ccc(N2CC(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C20H17F3N2O3/c1-12(26)13-2-8-17(9-3-13)25-11-14(10-18(25)27)19(28)24-16-6-4-15(5-7-16)20(21,22)23/h2-9,14H,10-11H2,1H3,(H,24,28) |
| InChIKey | JSRKATUNPQXDBJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |