C26H18F12 — CID 11318939
1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,3,5,6-tetramethylbenzene (PubChem CID 11318939) has the molecular formula C26H18F12 and a molecular weight of 558.41 g/mol. Its IUPAC name is 1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,3,5,6-tetramethylbenzene.
| Compound Name | 1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 11318939 |
| Molecular Formula | C26H18F12 |
| Molecular Weight | 558.41 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 1,4-bis[3,5-bis(trifluoromethyl)phenyl]-2,3,5,6-tetramethylbenzene |
| SMILES | Cc1c(C)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(C)c(C)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H18F12/c1-11-12(2)22(16-7-19(25(33,34)35)10-20(8-16)26(36,37)38)14(4)13(3)21(11)15-5-17(23(27,28)29)9-18(6-15)24(30,31)32/h5-10H,1-4H3 |
| InChIKey | BWHMOFDJYHFTQQ-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.41 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |