C29H58O6Si2 — CID 11318949
methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxododecanoate (PubChem CID 11318949) has the molecular formula C29H58O6Si2 and a molecular weight of 558.95 g/mol. Its IUPAC name is methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxododecanoate.
| Compound Name | methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxododecanoate |
|---|---|
| PubChem CID | 11318949 |
| Molecular Formula | C29H58O6Si2 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | methyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5,12-dioxododecanoate |
| SMILES | COC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCC=O |
| InChI | InChI=1S/C29H58O6Si2/c1-21(18-16-17-19-30)25(35-37(14,15)28(6,7)8)22(2)26(32)29(9,10)23(20-24(31)33-11)34-36(12,13)27(3,4)5/h19,21-23,25H,16-18,20H2,1-15H3/t21-,22+,23-,25-/m0/s1 |
| InChIKey | OULJKHZNOHNBOT-AANQFLQQSA-N |
| XLogP | 7.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|