C17H23N3O4S — CID 113189623
1-[4-(dimethylamino)phenyl]-N-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 113189623) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-N-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[4-(dimethylamino)phenyl]-N-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113189623 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-N-(1,1-dioxothiolan-3-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C)c1ccc(N2CC(C(=O)NC3CCS(=O)(=O)C3)CC2=O)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-19(2)14-3-5-15(6-4-14)20-10-12(9-16(20)21)17(22)18-13-7-8-25(23,24)11-13/h3-6,12-13H,7-11H2,1-2H3,(H,18,22) |
| InChIKey | IDNLLOCFFHQIOM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|