C24H28N2O3 — CID 113190121
N-cyclohexyl-5-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 113190121) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-cyclohexyl-5-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-cyclohexyl-5-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113190121 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-cyclohexyl-5-oxo-1-(4-phenylmethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CC(=O)N(c2ccc(OCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C24H28N2O3/c27-23-15-19(24(28)25-20-9-5-2-6-10-20)16-26(23)21-11-13-22(14-12-21)29-17-18-7-3-1-4-8-18/h1,3-4,7-8,11-14,19-20H,2,5-6,9-10,15-17H2,(H,25,28) |
| InChIKey | DAYGSGWVACQSFN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |