C23H34N2O2 — CID 113190469
N-cyclohexyl-1-[2,6-di(propan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 113190469) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-cyclohexyl-1-[2,6-di(propan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-cyclohexyl-1-[2,6-di(propan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113190469 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N-cyclohexyl-1-[2,6-di(propan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1N1CC(C(=O)NC2CCCCC2)CC1=O |
| InChI | InChI=1S/C23H34N2O2/c1-15(2)19-11-8-12-20(16(3)4)22(19)25-14-17(13-21(25)26)23(27)24-18-9-6-5-7-10-18/h8,11-12,15-18H,5-7,9-10,13-14H2,1-4H3,(H,24,27) |
| InChIKey | FYXMHZWSMGQSQZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |